C19H30NO4+ — CID 140646081
[(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-phenoxyoxonan-3-yl]azanium (PubChem CID 140646081) has the molecular formula C19H30NO4+ and a molecular weight of 336.45 g/mol. Its IUPAC name is [(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-phenoxyoxonan-3-yl]azanium.
| Compound Name | [(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-phenoxyoxonan-3-yl]azanium |
|---|---|
| PubChem CID | 140646081 |
| Molecular Formula | C19H30NO4+ |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | [(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-phenoxyoxonan-3-yl]azanium |
| SMILES | CC(C)CO[C@H]1CCC[C@H]([NH3+])C(=O)O[C@@H](C)[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-13(2)12-22-17-11-7-10-16(20)19(21)23-14(3)18(17)24-15-8-5-4-6-9-15/h4-6,8-9,13-14,16-18H,7,10-12,20H2,1-3H3/p+1/t14-,16-,17-,18-/m0/s1 |
| InChIKey | INNXYYSYSTXZOB-DKIMLUQUSA-O |
| XLogP | 2.20 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |