C46H41F5N2O9 — CID 140646536
(2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 140646536) has the molecular formula C46H41F5N2O9 and a molecular weight of 860.83 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 140646536 |
| Molecular Formula | C46H41F5N2O9 |
| Molecular Weight | 860.83 g/mol |
| Exact Mass | 860.27 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(NC(=O)OCCCCCCOC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1OC)c1c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)ccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C46H41F5N2O9/c1-4-32(34-30(21-20-29-35(34)43(55)53-42(29)54)44(56)62-41-39(50)37(48)36(47)38(49)40(41)51)52-45(57)60-23-13-5-6-14-24-61-46(26-15-9-7-10-16-26,27-17-11-8-12-18-27)31-22-19-28(58-2)25-33(31)59-3/h7-12,15-22,25,32H,4-6,13-14,23-24H2,1-3H3,(H,52,57)(H,53,54,55) |
| InChIKey | BQTHVFVUEZWRLD-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.83 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|