C17H26BF3O2 — CID 140646938
(1S,2S,6R)-4-[(2R)-3-cyclobutyl-1,1,1-trifluoropropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 140646938) has the molecular formula C17H26BF3O2 and a molecular weight of 330.20 g/mol. Its IUPAC name is (1S,2S,6R)-4-[(2R)-3-cyclobutyl-1,1,1-trifluoropropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R)-4-[(2R)-3-cyclobutyl-1,1,1-trifluoropropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 140646938 |
| Molecular Formula | C17H26BF3O2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (1S,2S,6R)-4-[(2R)-3-cyclobutyl-1,1,1-trifluoropropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC1(C)C2C[C@H]3OB([C@H](CC4CCC4)C(F)(F)F)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C17H26BF3O2/c1-15(2)11-8-12(15)16(3)14(9-11)22-18(23-16)13(17(19,20)21)7-10-5-4-6-10/h10-14H,4-9H2,1-3H3/t11?,12-,13+,14+,16-/m0/s1 |
| InChIKey | XIJCJANEVAGYKS-JTHRWRQESA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|