C18H19N3O4S — CID 14064698
ethyl 4-amino-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]benzoate (PubChem CID 14064698) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl 4-amino-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]benzoate.
| Compound Name | ethyl 4-amino-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]benzoate |
|---|---|
| PubChem CID | 14064698 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | ethyl 4-amino-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(CS(=O)c2nc3ccc(OC)cc3[nH]2)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-3-25-17(22)11-4-6-14(19)12(8-11)10-26(23)18-20-15-7-5-13(24-2)9-16(15)21-18/h4-9H,3,10,19H2,1-2H3,(H,20,21) |
| InChIKey | BYZZRNHFSCUDQS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|