About CID 140647181
CID 140647181 (PubChem CID 140647181) has the molecular formula C16H19NOS
and a molecular weight of 273.40 g/mol.
Molecular Properties
| Compound Name | CID 140647181 |
| PubChem CID | 140647181 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc([S+](=O)([CH-]c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C16H19NOS/c1-14-9-11-16(12-10-14)19(18,17(2)3)13-15-7-5-4-6-8-15/h4-13H,1-3H3 |
| InChIKey | TVYLLHVDDAZKMU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 140647181 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140647181?
The IUPAC name of CID 140647181 (CID 140647181) is not available.
What is the SMILES notation for CID 140647181?
The canonical SMILES for CID 140647181 is Cc1ccc([S+](=O)([CH-]c2ccccc2)N(C)C)cc1.
What is the InChIKey of CID 140647181?
The InChIKey is TVYLLHVDDAZKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NOS/c1-14-9-11-16(12-10-14)19(18,17(2)3)13-15-7-5-4-6-8-15/h4-13H,1-3H3.
What are the key properties of CID 140647181?
CID 140647181 has a molecular weight of 273.40 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140647181 is sourced from PubChem (CID 140647181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).