About 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol
4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol (PubChem CID 140647208) has the molecular formula C26H46OSi2
and a molecular weight of 430.83 g/mol. Its IUPAC name is 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol.
Molecular Properties
| Compound Name | 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol |
| PubChem CID | 140647208 |
| Molecular Formula | C26H46OSi2 |
| Molecular Weight | 430.83 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol |
| SMILES | C=CC[Si](CC=C)(CC=C)CCCC(C)(O)CCC[Si](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C26H46OSi2/c1-8-18-28(19-9-2,20-10-3)24-14-16-26(7,27)17-15-25-29(21-11-4,22-12-5)23-13-6/h8-13,27H,1-6,14-25H2,7H3 |
| InChIKey | BDIQHNZHFASRPA-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol?
The IUPAC name of 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol (CID 140647208) is 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol.
What is the SMILES notation for 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol?
The canonical SMILES for 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol is C=CC[Si](CC=C)(CC=C)CCCC(C)(O)CCC[Si](CC=C)(CC=C)CC=C.
What is the InChIKey of 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol?
The InChIKey is BDIQHNZHFASRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H46OSi2/c1-8-18-28(19-9-2,20-10-3)24-14-16-26(7,27)17-15-25-29(21-11-4,22-12-5)23-13-6/h8-13,27H,1-6,14-25H2,7H3.
What are the key properties of 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol?
4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol has a molecular weight of 430.83 g/mol, XLogP of 8.31, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,7-bis[tris(prop-2-enyl)silyl]heptan-4-ol is sourced from PubChem (CID 140647208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).