C16H12F9NO7S3 — CID 140648658
(6-ethylnaphthalen-2-yl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate (PubChem CID 140648658) has the molecular formula C16H12F9NO7S3 and a molecular weight of 597.46 g/mol. Its IUPAC name is (6-ethylnaphthalen-2-yl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate.
| Compound Name | (6-ethylnaphthalen-2-yl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 140648658 |
| Molecular Formula | C16H12F9NO7S3 |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 596.96 |
| IUPAC Name | (6-ethylnaphthalen-2-yl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propane-1-sulfonate |
| SMILES | CCc1ccc2cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C16H12F9NO7S3/c1-2-9-3-4-11-8-12(6-5-10(11)7-9)33-36(31,32)15(21,22)13(17,18)14(19,20)34(27,28)26-35(29,30)16(23,24)25/h3-8,26H,2H2,1H3 |
| InChIKey | KIMFXJXVPJKOQG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|