About tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane
tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane (PubChem CID 140649621) has the molecular formula C19H24Si
and a molecular weight of 280.49 g/mol. Its IUPAC name is tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane.
Molecular Properties
| Compound Name | tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane |
| PubChem CID | 140649621 |
| Molecular Formula | C19H24Si |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane |
| SMILES | CC(C)C[Si](C1=CC=CC1)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C19H24Si/c1-16(2)15-20(17-9-3-4-10-17,18-11-5-6-12-18)19-13-7-8-14-19/h3-9,11,13,16H,10,12,14-15H2,1-2H3 |
| InChIKey | UKNLSSKXILHHON-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane?
The IUPAC name of tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane (CID 140649621) is tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane.
What is the SMILES notation for tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane?
The canonical SMILES for tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane is CC(C)C[Si](C1=CC=CC1)(C1=CC=CC1)C1=CC=CC1.
What is the InChIKey of tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane?
The InChIKey is UKNLSSKXILHHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Si/c1-16(2)15-20(17-9-3-4-10-17,18-11-5-6-12-18)19-13-7-8-14-19/h3-9,11,13,16H,10,12,14-15H2,1-2H3.
What are the key properties of tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane?
tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane has a molecular weight of 280.49 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tri(cyclopenta-1,3-dien-1-yl)-(2-methylpropyl)silane is sourced from PubChem (CID 140649621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).