C27H30ClFN4O6S — CID 140651004
[1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]-[(1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)methyl]azanium chloride (PubChem CID 140651004) has the molecular formula C27H30ClFN4O6S and a molecular weight of 593.08 g/mol. Its IUPAC name is [1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]-[(1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)methyl]azanium chloride.
| Compound Name | [1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]-[(1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)methyl]azanium chloride |
|---|---|
| PubChem CID | 140651004 |
| Molecular Formula | C27H30ClFN4O6S |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | [1-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-1-hydroxyethyl]-2-oxabicyclo[2.2.2]octan-4-yl]-[(1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)methyl]azanium chloride |
| SMILES | COc1ccc2ncc(F)c(CC(O)C34CCC([NH2+]Cc5ccc6c(c5)NC(=O)CS6(=O)=O)(CC3)CO4)c2n1.[Cl-] |
| InChI | InChI=1S/C27H29FN4O6S.ClH/c1-37-24-5-3-19-25(32-24)17(18(28)13-29-19)11-22(33)27-8-6-26(7-9-27,15-38-27)30-12-16-2-4-21-20(10-16)31-23(34)14-39(21,35)36;/h2-5,10,13,22,30,33H,6-9,11-12,14-15H2,1H3,(H,31,34);1H |
| InChIKey | NRWZRNYHOCZLGD-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |