C9H15N3O — CID 140651662
(3R,4R,5S)-5-azido-3-methoxy-1,4-dimethylcyclohexene (PubChem CID 140651662) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (3R,4R,5S)-5-azido-3-methoxy-1,4-dimethylcyclohexene.
| Compound Name | (3R,4R,5S)-5-azido-3-methoxy-1,4-dimethylcyclohexene |
|---|---|
| PubChem CID | 140651662 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (3R,4R,5S)-5-azido-3-methoxy-1,4-dimethylcyclohexene |
| SMILES | CO[C@@H]1C=C(C)C[C@H](N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C9H15N3O/c1-6-4-8(11-12-10)7(2)9(5-6)13-3/h5,7-9H,4H2,1-3H3/t7-,8+,9-/m1/s1 |
| InChIKey | BRPSZUWSHZILIZ-HRDYMLBCSA-N |
| XLogP | 2.67 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|