C25H43FN4O2 — CID 140651877
N-[4-[1-(5-fluoro-2-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 140651877) has the molecular formula C25H43FN4O2 and a molecular weight of 450.64 g/mol. Its IUPAC name is N-[4-[1-(5-fluoro-2-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(5-fluoro-2-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140651877 |
| Molecular Formula | C25H43FN4O2 |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | N-[4-[1-(5-fluoro-2-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | CC1CCC(F)CC1C(=O)N1CCC(CCCCNC(=O)C2CC3CNCCC3N2)CC1 |
| InChI | InChI=1S/C25H43FN4O2/c1-17-5-6-20(26)15-21(17)25(32)30-12-8-18(9-13-30)4-2-3-10-28-24(31)23-14-19-16-27-11-7-22(19)29-23/h17-23,27,29H,2-16H2,1H3,(H,28,31) |
| InChIKey | TYDPKBQHFAUIFO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|