C18H26F5N3OS — CID 140652095
(6Z)-6-(dimethylhydrazinylidene)-7,7,7-trifluoro-4-(fluoromethyl)-4-(2-fluoro-3-methylphenyl)-2-methylheptane-2-sulfinamide (PubChem CID 140652095) has the molecular formula C18H26F5N3OS and a molecular weight of 427.48 g/mol. Its IUPAC name is (6Z)-6-(dimethylhydrazinylidene)-7,7,7-trifluoro-4-(fluoromethyl)-4-(2-fluoro-3-methylphenyl)-2-methylheptane-2-sulfinamide.
| Compound Name | (6Z)-6-(dimethylhydrazinylidene)-7,7,7-trifluoro-4-(fluoromethyl)-4-(2-fluoro-3-methylphenyl)-2-methylheptane-2-sulfinamide |
|---|---|
| PubChem CID | 140652095 |
| Molecular Formula | C18H26F5N3OS |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (6Z)-6-(dimethylhydrazinylidene)-7,7,7-trifluoro-4-(fluoromethyl)-4-(2-fluoro-3-methylphenyl)-2-methylheptane-2-sulfinamide |
| SMILES | Cc1cccc(C(CF)(C/C(=N/N(C)C)C(F)(F)F)CC(C)(C)S(N)=O)c1F |
| InChI | InChI=1S/C18H26F5N3OS/c1-12-7-6-8-13(15(12)20)17(11-19,10-16(2,3)28(24)27)9-14(18(21,22)23)25-26(4)5/h6-8H,9-11,24H2,1-5H3/b25-14- |
| InChIKey | SYWVBEWEFPVNGF-QFEZKATASA-N |
| XLogP | 4.00 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|