C24H35FN4O4S — CID 140653781
N-[4-(4,4-dimethyl-1,3-dioxan-2-yl)butyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine (PubChem CID 140653781) has the molecular formula C24H35FN4O4S and a molecular weight of 494.63 g/mol. Its IUPAC name is N-[4-(4,4-dimethyl-1,3-dioxan-2-yl)butyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | N-[4-(4,4-dimethyl-1,3-dioxan-2-yl)butyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 140653781 |
| Molecular Formula | C24H35FN4O4S |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[4-(4,4-dimethyl-1,3-dioxan-2-yl)butyl]-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2CC(NCCCCC3OCCC(C)(C)O3)C(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C24H35FN4O4S/c1-24(2)11-13-32-23(33-24)6-4-5-12-26-21-15-29(34(30,31)22-16-28(3)17-27-22)14-20(21)18-7-9-19(25)10-8-18/h7-10,16-17,20-21,23,26H,4-6,11-15H2,1-3H3 |
| InChIKey | MAKZNFUPFMNPHW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|