About 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine
4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine (PubChem CID 140654065) has the molecular formula C29H25N3O
and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine.
Molecular Properties
| Compound Name | 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine |
| PubChem CID | 140654065 |
| Molecular Formula | C29H25N3O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine |
| SMILES | CN1CCOC(=N\c2ccc(-c3ccccc3)cc2)/C1=N\c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N3O/c1-32-20-21-33-29(31-27-18-14-25(15-19-27)23-10-6-3-7-11-23)28(32)30-26-16-12-24(13-17-26)22-8-4-2-5-9-22/h2-19H,20-21H2,1H3/b30-28+,31-29- |
| InChIKey | BQBVEJBHFOKDLZ-MCDSGTGBSA-N |
| XLogP | 6.74 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine?
The IUPAC name of 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine (CID 140654065) is 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine.
What is the SMILES notation for 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine?
The canonical SMILES for 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine is CN1CCOC(=N\c2ccc(-c3ccccc3)cc2)/C1=N\c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine?
The InChIKey is BQBVEJBHFOKDLZ-MCDSGTGBSA-N. The full InChI is InChI=1S/C29H25N3O/c1-32-20-21-33-29(31-27-18-14-25(15-19-27)23-10-6-3-7-11-23)28(32)30-26-16-12-24(13-17-26)22-8-4-2-5-9-22/h2-19H,20-21H2,1H3/b30-28+,31-29-.
What are the key properties of 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine?
4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine has a molecular weight of 431.54 g/mol, XLogP of 6.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-N,3-N-bis(4-phenylphenyl)morpholine-2,3-diimine is sourced from PubChem (CID 140654065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).