About (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate
(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate (PubChem CID 140655039) has the molecular formula C33H35O3S+
and a molecular weight of 511.71 g/mol. Its IUPAC name is (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate.
Molecular Properties
| Compound Name | (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate |
| PubChem CID | 140655039 |
| Molecular Formula | C33H35O3S+ |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate |
| SMILES | Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1COC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C33H35O3S/c1-20-12-26(37-30-10-6-4-8-27(30)28-9-5-7-11-31(28)37)13-21(2)29(20)19-35-32(34)36-33(3)24-15-22-14-23(17-24)18-25(33)16-22/h4-13,22-25H,14-19H2,1-3H3/q+1 |
| InChIKey | FPLMBYYJFITNMM-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate?
The IUPAC name of (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate (CID 140655039) is (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate.
What is the SMILES notation for (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate?
The canonical SMILES for (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate is Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1COC(=O)OC1(C)C2CC3CC(C2)CC1C3.
What is the InChIKey of (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate?
The InChIKey is FPLMBYYJFITNMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H35O3S/c1-20-12-26(37-30-10-6-4-8-27(30)28-9-5-7-11-31(28)37)13-21(2)29(20)19-35-32(34)36-33(3)24-15-22-14-23(17-24)18-25(33)16-22/h4-13,22-25H,14-19H2,1-3H3/q+1.
What are the key properties of (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate?
(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate has a molecular weight of 511.71 g/mol, XLogP of 9.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenyl)methyl (2-methyl-2-adamantyl) carbonate is sourced from PubChem (CID 140655039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).