C12H20O3S — CID 140655045
1,2,3,7,8-pentamethyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide (PubChem CID 140655045) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 1,2,3,7,8-pentamethyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide.
| Compound Name | 1,2,3,7,8-pentamethyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
|---|---|
| PubChem CID | 140655045 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1,2,3,7,8-pentamethyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
| SMILES | CC1C2(C)CC3C(C)(C2C)C1(C)OS3(=O)=O |
| InChI | InChI=1S/C12H20O3S/c1-7-10(3)6-9-11(7,4)12(5,8(10)2)15-16(9,13)14/h7-9H,6H2,1-5H3 |
| InChIKey | PJJUVPZTPIBFPH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|