C7H9N3O5S — CID 140655767
[(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140655767) has the molecular formula C7H9N3O5S and a molecular weight of 247.23 g/mol. Its IUPAC name is [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140655767 |
| Molecular Formula | C7H9N3O5S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [C-]#[N+][C@@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C7H9N3O5S/c1-8-6-3-2-5-4-9(6)7(11)10(5)15-16(12,13)14/h5-6H,2-4H2,(H,12,13,14)/t5-,6-/m0/s1 |
| InChIKey | KMLPQWWNADCWBM-WDSKDSINSA-N |
| XLogP | -0.13 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|