About [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite
[3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite (PubChem CID 140655843) has the molecular formula C10H6F3N5O3
and a molecular weight of 301.18 g/mol. Its IUPAC name is [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite.
Molecular Properties
| Compound Name | [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite |
| PubChem CID | 140655843 |
| Molecular Formula | C10H6F3N5O3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite |
| SMILES | N#Cc1c(Nc2ccc(OF)c(OF)c2OF)n[nH]c1N |
| InChI | InChI=1S/C10H6F3N5O3/c11-19-6-2-1-5(7(20-12)8(6)21-13)16-10-4(3-14)9(15)17-18-10/h1-2H,(H4,15,16,17,18) |
| InChIKey | HHMRKUVBSGCUIJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite?
The IUPAC name of [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite (CID 140655843) is [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite.
What is the SMILES notation for [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite?
The canonical SMILES for [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite is N#Cc1c(Nc2ccc(OF)c(OF)c2OF)n[nH]c1N.
What is the InChIKey of [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite?
The InChIKey is HHMRKUVBSGCUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3N5O3/c11-19-6-2-1-5(7(20-12)8(6)21-13)16-10-4(3-14)9(15)17-18-10/h1-2H,(H4,15,16,17,18).
What are the key properties of [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite?
[3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite has a molecular weight of 301.18 g/mol, XLogP of 2.40, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5-amino-4-cyano-1H-pyrazol-3-yl)amino]-2,6-difluorooxyphenyl] hypofluorite is sourced from PubChem (CID 140655843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).