C15H26Br2N2 — CID 140656679
3-(2,7-dibromo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-9-yl)propan-1-amine (PubChem CID 140656679) has the molecular formula C15H26Br2N2 and a molecular weight of 394.20 g/mol. Its IUPAC name is 3-(2,7-dibromo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-9-yl)propan-1-amine.
| Compound Name | 3-(2,7-dibromo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 140656679 |
| Molecular Formula | C15H26Br2N2 |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 3-(2,7-dibromo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-9-yl)propan-1-amine |
| SMILES | NCCCN1C2CC(Br)CCC2C2CCC(Br)CC21 |
| InChI | InChI=1S/C15H26Br2N2/c16-10-2-4-12-13-5-3-11(17)9-15(13)19(7-1-6-18)14(12)8-10/h10-15H,1-9,18H2 |
| InChIKey | MOFCTQLIIWOVQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|