C26H30OSi — CID 140657608
1H-inden-1-yl-(2-methoxyphenyl)-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 140657608) has the molecular formula C26H30OSi and a molecular weight of 386.61 g/mol. Its IUPAC name is 1H-inden-1-yl-(2-methoxyphenyl)-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | 1H-inden-1-yl-(2-methoxyphenyl)-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 140657608 |
| Molecular Formula | C26H30OSi |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1H-inden-1-yl-(2-methoxyphenyl)-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | COc1ccccc1[Si](C)(C1C(C)=C(C)C(C)=C1C)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C26H30OSi/c1-17-18(2)20(4)26(19(17)3)28(6,25-14-10-9-13-23(25)27-5)24-16-15-21-11-7-8-12-22(21)24/h7-16,24,26H,1-6H3 |
| InChIKey | IPAKAHROTYFCQH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|