C11H21BN2O3 — CID 140657673
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyrazol-2-yl]ethanol (PubChem CID 140657673) has the molecular formula C11H21BN2O3 and a molecular weight of 240.11 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyrazol-2-yl]ethanol.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyrazol-2-yl]ethanol |
|---|---|
| PubChem CID | 140657673 |
| Molecular Formula | C11H21BN2O3 |
| Molecular Weight | 240.11 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyrazol-2-yl]ethanol |
| SMILES | CC1(C)OB(C2C=NN(CCO)C2)OC1(C)C |
| InChI | InChI=1S/C11H21BN2O3/c1-10(2)11(3,4)17-12(16-10)9-7-13-14(8-9)5-6-15/h7,9,15H,5-6,8H2,1-4H3 |
| InChIKey | ROKKNRBDRLURJW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.11 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|