C25H28ClN7O2 — CID 140658019
(Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one (PubChem CID 140658019) has the molecular formula C25H28ClN7O2 and a molecular weight of 494.00 g/mol. Its IUPAC name is (Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one.
| Compound Name | (Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 140658019 |
| Molecular Formula | C25H28ClN7O2 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\C(C)(C)C)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Cl)c(OC)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C25H28ClN7O2/c1-25(2,3)12-18(28-4)24(34)32-10-6-7-16(13-32)33-23-20(22(27)29-14-30-23)21(31-33)15-8-9-17(26)19(11-15)35-5/h8-9,11-12,14,16H,6-7,10,13H2,1-3,5H3,(H2,27,29,30)/b18-12-/t16-/m1/s1 |
| InChIKey | WHJMLHUENNUWOD-UWCCDQBKSA-N |
| XLogP | 4.75 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|