C16H34O3Si — CID 140658603
(E,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-7-methylnon-6-ene-4,5-diol (PubChem CID 140658603) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (E,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-7-methylnon-6-ene-4,5-diol.
| Compound Name | (E,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-7-methylnon-6-ene-4,5-diol |
|---|---|
| PubChem CID | 140658603 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (E,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-7-methylnon-6-ene-4,5-diol |
| SMILES | CC/C(C)=C/[C@H](O)[C@@H](O)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-9-12(2)10-14(17)15(18)11-13(3)19-20(7,8)16(4,5)6/h10,13-15,17-18H,9,11H2,1-8H3/b12-10+/t13-,14-,15-/m0/s1 |
| InChIKey | NVWBMPVZEAEGII-XDYFHEAFSA-N |
| XLogP | 3.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|