C17H32O4Si — CID 140658608
(4S,5S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[(E)-2-methylbut-1-enyl]-1,3-dioxolan-2-one (PubChem CID 140658608) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (4S,5S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[(E)-2-methylbut-1-enyl]-1,3-dioxolan-2-one.
| Compound Name | (4S,5S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[(E)-2-methylbut-1-enyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 140658608 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (4S,5S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-5-[(E)-2-methylbut-1-enyl]-1,3-dioxolan-2-one |
| SMILES | CC/C(C)=C/[C@@H]1OC(=O)O[C@H]1C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-9-12(2)10-14-15(20-16(18)19-14)11-13(3)21-22(7,8)17(4,5)6/h10,13-15H,9,11H2,1-8H3/b12-10+/t13-,14-,15-/m0/s1 |
| InChIKey | HEJSQFOGJOMDCE-XDYFHEAFSA-N |
| XLogP | 5.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|