C22H30FN3O2 — CID 140659151
tert-butyl N-[2-(tert-butylamino)-5-[(4-fluorophenyl)methylimino]cyclohex-3-en-1-ylidene]carbamate (PubChem CID 140659151) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is tert-butyl N-[2-(tert-butylamino)-5-[(4-fluorophenyl)methylimino]cyclohex-3-en-1-ylidene]carbamate.
| Compound Name | tert-butyl N-[2-(tert-butylamino)-5-[(4-fluorophenyl)methylimino]cyclohex-3-en-1-ylidene]carbamate |
|---|---|
| PubChem CID | 140659151 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | tert-butyl N-[2-(tert-butylamino)-5-[(4-fluorophenyl)methylimino]cyclohex-3-en-1-ylidene]carbamate |
| SMILES | CC(C)(C)NC1C=C/C(=N\Cc2ccc(F)cc2)CC1=NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30FN3O2/c1-21(2,3)26-18-12-11-17(24-14-15-7-9-16(23)10-8-15)13-19(18)25-20(27)28-22(4,5)6/h7-12,18,26H,13-14H2,1-6H3/b24-17+,25-19? |
| InChIKey | ZBMUCLOYLURDAS-ZKMBXKCZSA-N |
| XLogP | 4.86 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|