About CID 140659181
CID 140659181 (PubChem CID 140659181) has the molecular formula C12H13BrN3O
and a molecular weight of 295.16 g/mol.
Molecular Properties
| Compound Name | CID 140659181 |
| PubChem CID | 140659181 |
| Molecular Formula | C12H13BrN3O |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ncc(Br)cc2CC12CC[N]CC2 |
| InChI | InChI=1S/C12H13BrN3O/c13-9-5-8-6-12(1-3-14-4-2-12)11(17)16-10(8)15-7-9/h5,7H,1-4,6H2,(H,15,16,17) |
| InChIKey | JMLTVXBONMJGRY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 140659181 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140659181?
The IUPAC name of CID 140659181 (CID 140659181) is not available.
What is the SMILES notation for CID 140659181?
The canonical SMILES for CID 140659181 is O=C1Nc2ncc(Br)cc2CC12CC[N]CC2.
What is the InChIKey of CID 140659181?
The InChIKey is JMLTVXBONMJGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN3O/c13-9-5-8-6-12(1-3-14-4-2-12)11(17)16-10(8)15-7-9/h5,7H,1-4,6H2,(H,15,16,17).
What are the key properties of CID 140659181?
CID 140659181 has a molecular weight of 295.16 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140659181 is sourced from PubChem (CID 140659181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).