C45H69N4O2+ — CID 140659402
4-tert-butyl-2-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-[4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)butyl]phenol (PubChem CID 140659402) has the molecular formula C45H69N4O2+ and a molecular weight of 698.07 g/mol. Its IUPAC name is 4-tert-butyl-2-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-[4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)butyl]phenol.
| Compound Name | 4-tert-butyl-2-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-[4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)butyl]phenol |
|---|---|
| PubChem CID | 140659402 |
| Molecular Formula | C45H69N4O2+ |
| Molecular Weight | 698.07 g/mol |
| Exact Mass | 697.54 |
| IUPAC Name | 4-tert-butyl-2-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-[4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)butyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/C2CCCCC2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(CCCCN2CCC[N+]3=C2CCCCC3)c1 |
| InChI | InChI=1S/C45H68N4O2/c1-43(2,3)35-26-32(18-14-16-23-49-25-17-24-48-22-15-10-11-21-40(48)49)41(50)33(27-35)30-46-38-19-12-13-20-39(38)47-31-34-28-36(44(4,5)6)29-37(42(34)51)45(7,8)9/h26-31,38-39H,10-25H2,1-9H3,(H-,46,47,50,51)/p+1 |
| InChIKey | DAMNAOZSWMRJLQ-UHFFFAOYSA-O |
| XLogP | 9.85 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.07 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|