About CID 140659668
CID 140659668 (PubChem CID 140659668) has the molecular formula C9H17N2O3S
and a molecular weight of 233.31 g/mol.
Molecular Properties
| Compound Name | CID 140659668 |
| PubChem CID | 140659668 |
| Molecular Formula | C9H17N2O3S |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | — |
| SMILES | [CH2]C(=O)C1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C9H17N2O3S/c1-8(12)9-4-6-11(7-5-9)15(13,14)10(2)3/h9H,1,4-7H2,2-3H3 |
| InChIKey | OGCMITGVZXERCP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 140659668 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140659668?
The IUPAC name of CID 140659668 (CID 140659668) is not available.
What is the SMILES notation for CID 140659668?
The canonical SMILES for CID 140659668 is [CH2]C(=O)C1CCN(S(=O)(=O)N(C)C)CC1.
What is the InChIKey of CID 140659668?
The InChIKey is OGCMITGVZXERCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N2O3S/c1-8(12)9-4-6-11(7-5-9)15(13,14)10(2)3/h9H,1,4-7H2,2-3H3.
What are the key properties of CID 140659668?
CID 140659668 has a molecular weight of 233.31 g/mol, XLogP of -0.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140659668 is sourced from PubChem (CID 140659668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).