C9H11N2O — CID 140659718
CID 140659718 (PubChem CID 140659718) has the molecular formula C9H11N2O and a molecular weight of 163.20 g/mol.
| Compound Name | CID 140659718 |
|---|---|
| PubChem CID | 140659718 |
| Molecular Formula | C9H11N2O |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | — |
| SMILES | [CH2]C(=O)c1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C9H11N2O/c1-7(12)8-4-5-9(10-6-8)11(2)3/h4-6H,1H2,2-3H3 |
| InChIKey | VXQFZKOKBKXNDE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |