About 1-propan-2-yl-1,2,4-triazole-3-carboxylate
1-propan-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 140659841) has the molecular formula C6H8N3O2-
and a molecular weight of 154.15 g/mol. Its IUPAC name is 1-propan-2-yl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | 1-propan-2-yl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 140659841 |
| Molecular Formula | C6H8N3O2- |
| Molecular Weight | 154.15 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-propan-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | CC(C)n1cnc(C(=O)[O-])n1 |
| InChI | InChI=1S/C6H9N3O2/c1-4(2)9-3-7-5(8-9)6(10)11/h3-4H,1-2H3,(H,10,11)/p-1 |
| InChIKey | ITSXMBPUAOXJII-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-propan-2-yl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-1,2,4-triazole-3-carboxylate?
The IUPAC name of 1-propan-2-yl-1,2,4-triazole-3-carboxylate (CID 140659841) is 1-propan-2-yl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for 1-propan-2-yl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for 1-propan-2-yl-1,2,4-triazole-3-carboxylate is CC(C)n1cnc(C(=O)[O-])n1.
What is the InChIKey of 1-propan-2-yl-1,2,4-triazole-3-carboxylate?
The InChIKey is ITSXMBPUAOXJII-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9N3O2/c1-4(2)9-3-7-5(8-9)6(10)11/h3-4H,1-2H3,(H,10,11)/p-1.
What are the key properties of 1-propan-2-yl-1,2,4-triazole-3-carboxylate?
1-propan-2-yl-1,2,4-triazole-3-carboxylate has a molecular weight of 154.15 g/mol, XLogP of -0.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 140659841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).