About ethyl 2-(methylamino)butanoate;hydrochloride
ethyl 2-(methylamino)butanoate;hydrochloride (PubChem CID 140660246) has the molecular formula C7H16ClNO2
and a molecular weight of 181.66 g/mol. Its IUPAC name is ethyl 2-(methylamino)butanoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-(methylamino)butanoate;hydrochloride |
| PubChem CID | 140660246 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | ethyl 2-(methylamino)butanoate;hydrochloride |
| SMILES | CCOC(=O)C(CC)NC.Cl |
| InChI | InChI=1S/C7H15NO2.ClH/c1-4-6(8-3)7(9)10-5-2;/h6,8H,4-5H2,1-3H3;1H |
| InChIKey | MTPOXOQPYFZJKT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(methylamino)butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(methylamino)butanoate;hydrochloride?
The IUPAC name of ethyl 2-(methylamino)butanoate;hydrochloride (CID 140660246) is ethyl 2-(methylamino)butanoate;hydrochloride.
What is the SMILES notation for ethyl 2-(methylamino)butanoate;hydrochloride?
The canonical SMILES for ethyl 2-(methylamino)butanoate;hydrochloride is CCOC(=O)C(CC)NC.Cl.
What is the InChIKey of ethyl 2-(methylamino)butanoate;hydrochloride?
The InChIKey is MTPOXOQPYFZJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.ClH/c1-4-6(8-3)7(9)10-5-2;/h6,8H,4-5H2,1-3H3;1H.
What are the key properties of ethyl 2-(methylamino)butanoate;hydrochloride?
ethyl 2-(methylamino)butanoate;hydrochloride has a molecular weight of 181.66 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(methylamino)butanoate;hydrochloride is sourced from PubChem (CID 140660246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).