About azane;1-cyclobutylbutan-1-amine;dihydrate
azane;1-cyclobutylbutan-1-amine;dihydrate (PubChem CID 140660348) has the molecular formula C8H24N2O2
and a molecular weight of 180.29 g/mol. Its IUPAC name is azane;1-cyclobutylbutan-1-amine;dihydrate.
Molecular Properties
| Compound Name | azane;1-cyclobutylbutan-1-amine;dihydrate |
| PubChem CID | 140660348 |
| Molecular Formula | C8H24N2O2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.18 |
| IUPAC Name | azane;1-cyclobutylbutan-1-amine;dihydrate |
| SMILES | CCCC(N)C1CCC1.N.O.O |
| InChI | InChI=1S/C8H17N.H3N.2H2O/c1-2-4-8(9)7-5-3-6-7;;;/h7-8H,2-6,9H2,1H3;1H3;2*1H2 |
| InChIKey | JZWZSDVKCPJFGI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1-cyclobutylbutan-1-amine;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-cyclobutylbutan-1-amine;dihydrate?
The IUPAC name of azane;1-cyclobutylbutan-1-amine;dihydrate (CID 140660348) is azane;1-cyclobutylbutan-1-amine;dihydrate.
What is the SMILES notation for azane;1-cyclobutylbutan-1-amine;dihydrate?
The canonical SMILES for azane;1-cyclobutylbutan-1-amine;dihydrate is CCCC(N)C1CCC1.N.O.O.
What is the InChIKey of azane;1-cyclobutylbutan-1-amine;dihydrate?
The InChIKey is JZWZSDVKCPJFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.H3N.2H2O/c1-2-4-8(9)7-5-3-6-7;;;/h7-8H,2-6,9H2,1H3;1H3;2*1H2.
What are the key properties of azane;1-cyclobutylbutan-1-amine;dihydrate?
azane;1-cyclobutylbutan-1-amine;dihydrate has a molecular weight of 180.29 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-cyclobutylbutan-1-amine;dihydrate is sourced from PubChem (CID 140660348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).