C15H7F4O5S- — CID 140660544
4-(4-ethenylphenoxy)carbonyl-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140660544) has the molecular formula C15H7F4O5S- and a molecular weight of 375.28 g/mol. Its IUPAC name is 4-(4-ethenylphenoxy)carbonyl-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(4-ethenylphenoxy)carbonyl-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140660544 |
| Molecular Formula | C15H7F4O5S- |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 4-(4-ethenylphenoxy)carbonyl-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=Cc1ccc(OC(=O)c2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C15H8F4O5S/c1-2-7-3-5-8(6-4-7)24-15(20)9-10(16)12(18)14(25(21,22)23)13(19)11(9)17/h2-6H,1H2,(H,21,22,23)/p-1 |
| InChIKey | MHTADFMDYSLTIM-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|