C21H21F4O4S- — CID 140660554
4-[2-ethyl-4,6-di(propan-2-yl)benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140660554) has the molecular formula C21H21F4O4S- and a molecular weight of 445.45 g/mol. Its IUPAC name is 4-[2-ethyl-4,6-di(propan-2-yl)benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2-ethyl-4,6-di(propan-2-yl)benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140660554 |
| Molecular Formula | C21H21F4O4S- |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 4-[2-ethyl-4,6-di(propan-2-yl)benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCc1cc(C(C)C)cc(C(C)C)c1C(=O)c1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C21H22F4O4S/c1-6-11-7-12(9(2)3)8-13(10(4)5)14(11)20(26)15-16(22)18(24)21(30(27,28)29)19(25)17(15)23/h7-10H,6H2,1-5H3,(H,27,28,29)/p-1 |
| InChIKey | QCYNMHCBMWTARN-UHFFFAOYSA-M |
| XLogP | 5.19 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|