C33H37IN+ — CID 140662144
(4-iodo-2,6-diphenylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]azanium (PubChem CID 140662144) has the molecular formula C33H37IN+ and a molecular weight of 574.57 g/mol. Its IUPAC name is (4-iodo-2,6-diphenylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]azanium.
| Compound Name | (4-iodo-2,6-diphenylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]azanium |
|---|---|
| PubChem CID | 140662144 |
| Molecular Formula | C33H37IN+ |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | (4-iodo-2,6-diphenylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]azanium |
| SMILES | CC(C)c1cc(C(C)C)c([NH2+]c2c(-c3ccccc3)cc(I)cc2-c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C33H36IN/c1-21(2)26-17-28(22(3)4)32(29(18-26)23(5)6)35-33-30(24-13-9-7-10-14-24)19-27(34)20-31(33)25-15-11-8-12-16-25/h7-23,35H,1-6H3/p+1 |
| InChIKey | NVZLELQCSJNVMF-UHFFFAOYSA-O |
| XLogP | 9.52 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|