C14H21NS — CID 140662399
(3Z,5E,8Z)-3-ethylidene-2-methyl-10-methylsulfanyldeca-1,5,8-trien-4-imine (PubChem CID 140662399) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is (3Z,5E,8Z)-3-ethylidene-2-methyl-10-methylsulfanyldeca-1,5,8-trien-4-imine.
| Compound Name | (3Z,5E,8Z)-3-ethylidene-2-methyl-10-methylsulfanyldeca-1,5,8-trien-4-imine |
|---|---|
| PubChem CID | 140662399 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (3Z,5E,8Z)-3-ethylidene-2-methyl-10-methylsulfanyldeca-1,5,8-trien-4-imine |
| SMILES | [H]/N=C(\C=C\C/C=C\CSC)C(=C\C)/C(=C)C |
| InChI | InChI=1S/C14H21NS/c1-5-13(12(2)3)14(15)10-8-6-7-9-11-16-4/h5,7-10,15H,2,6,11H2,1,3-4H3/b9-7-,10-8+,13-5-,15-14+ |
| InChIKey | XMTNNCCTYYUWRW-FJPJYSESSA-N |
| XLogP | 4.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|