About (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+)
(tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) (PubChem CID 140662685) has the molecular formula C12H27Cl3NPTi
and a molecular weight of 370.56 g/mol. Its IUPAC name is (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+).
Molecular Properties
| Compound Name | (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) |
| PubChem CID | 140662685 |
| Molecular Formula | C12H27Cl3NPTi |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) |
| SMILES | CC(C)(C)P(=[N-])(C(C)(C)C)C(C)(C)C.Cl[Ti+](Cl)Cl |
| InChI | InChI=1S/C12H27NP.3ClH.Ti/c1-10(2,3)14(13,11(4,5)6)12(7,8)9;;;;/h1-9H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | GLHZOINIGBMPRH-UHFFFAOYSA-K |
| XLogP | 7.22 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+)?
The IUPAC name of (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) (CID 140662685) is (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+).
What is the SMILES notation for (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+)?
The canonical SMILES for (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) is CC(C)(C)P(=[N-])(C(C)(C)C)C(C)(C)C.Cl[Ti+](Cl)Cl.
What is the InChIKey of (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+)?
The InChIKey is GLHZOINIGBMPRH-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H27NP.3ClH.Ti/c1-10(2,3)14(13,11(4,5)6)12(7,8)9;;;;/h1-9H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+)?
(tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) has a molecular weight of 370.56 g/mol, XLogP of 7.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (tritert-butyl-λ5-phosphanylidene)azanide;trichlorotitanium(1+) is sourced from PubChem (CID 140662685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).