C20H28ClN5O4 — CID 140663324
tert-butyl N-[2-[[2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 140663324) has the molecular formula C20H28ClN5O4 and a molecular weight of 437.93 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 140663324 |
| Molecular Formula | C20H28ClN5O4 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | tert-butyl N-[2-[[2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | Cc1oc(-c2cnc(Cl)cc2NC(C)C)nc1C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28ClN5O4/c1-11(2)25-14-9-15(21)24-10-13(14)18-26-16(12(3)29-18)17(27)22-7-8-23-19(28)30-20(4,5)6/h9-11H,7-8H2,1-6H3,(H,22,27)(H,23,28)(H,24,25) |
| InChIKey | HZTUKQVFANHQLV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|