C33H36B2N2O8 — CID 140663571
5-[phenyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-5-yl]oxy]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (PubChem CID 140663571) has the molecular formula C33H36B2N2O8 and a molecular weight of 610.28 g/mol. Its IUPAC name is 5-[phenyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-5-yl]oxy]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole.
| Compound Name | 5-[phenyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-5-yl]oxy]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 140663571 |
| Molecular Formula | C33H36B2N2O8 |
| Molecular Weight | 610.28 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | 5-[phenyl-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-5-yl]oxy]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| SMILES | CC1(C)OB(c2nc3cc(OC(Oc4ccc5oc(B6OC(C)(C)C(C)(C)O6)nc5c4)c4ccccc4)ccc3o2)OC1(C)C |
| InChI | InChI=1S/C33H36B2N2O8/c1-30(2)31(3,4)43-34(42-30)28-36-23-18-21(14-16-25(23)40-28)38-27(20-12-10-9-11-13-20)39-22-15-17-26-24(19-22)37-29(41-26)35-44-32(5,6)33(7,8)45-35/h9-19,27H,1-8H3 |
| InChIKey | BKIIKKIDHAOSPQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 107.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|