C23H34O3 — CID 140663611
2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-dione (PubChem CID 140663611) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-dione.
| Compound Name | 2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 140663611 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-dione |
| SMILES | COC1=CC(=O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)C1=O |
| InChI | InChI=1S/C23H34O3/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-20-19(5)23(25)22(26-6)15-21(20)24/h9,11,13,15,19-20H,7-8,10,12,14H2,1-6H3/b17-11+,18-13+ |
| InChIKey | MQWLNAQNEHEDLL-OUBUNXTGSA-N |
| XLogP | 5.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|