C21H32N4O4 — CID 140663865
2-(aminomethyl)-1-ethyl-3-[[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]methyl]benzimidazol-1-ium-5-olate (PubChem CID 140663865) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-(aminomethyl)-1-ethyl-3-[[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]methyl]benzimidazol-1-ium-5-olate.
| Compound Name | 2-(aminomethyl)-1-ethyl-3-[[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]methyl]benzimidazol-1-ium-5-olate |
|---|---|
| PubChem CID | 140663865 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-(aminomethyl)-1-ethyl-3-[[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]methyl]benzimidazol-1-ium-5-olate |
| SMILES | CC[n+]1c(CN)n(CC2CCN(C(=O)COCCOC)CC2)c2cc([O-])ccc21 |
| InChI | InChI=1S/C21H32N4O4/c1-3-24-18-5-4-17(26)12-19(18)25(20(24)13-22)14-16-6-8-23(9-7-16)21(27)15-29-11-10-28-2/h4-5,12,16H,3,6-11,13-15,22H2,1-2H3 |
| InChIKey | QPAMBWOYVXTPJH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|