C37H23F5Zr — CID 140664283
benzhydrylidenezirconium(2+);1-cyclopenta-1,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;9H-fluoren-9-ide (PubChem CID 140664283) has the molecular formula C37H23F5Zr and a molecular weight of 653.81 g/mol. Its IUPAC name is benzhydrylidenezirconium(2+);1-cyclopenta-1,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;9H-fluoren-9-ide.
| Compound Name | benzhydrylidenezirconium(2+);1-cyclopenta-1,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;9H-fluoren-9-ide |
|---|---|
| PubChem CID | 140664283 |
| Molecular Formula | C37H23F5Zr |
| Molecular Weight | 653.81 g/mol |
| Exact Mass | 652.08 |
| IUPAC Name | benzhydrylidenezirconium(2+);1-cyclopenta-1,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;9H-fluoren-9-ide |
| SMILES | Fc1c(F)c(F)c(C2=[C-]CC=C2)c(F)c1F.[Zr+2]=C(c1ccccc1)c1ccccc1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C13H10.C11H4F5.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;12-7-6(5-3-1-2-4-5)8(13)10(15)11(16)9(7)14;/h1-9H;1-10H;1,3H,2H2;/q-1;;-1;+2 |
| InChIKey | MWDGCGLDZMUWBR-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.81 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|