About chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane
chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane (PubChem CID 140664464) has the molecular formula C28H39ClSi
and a molecular weight of 439.16 g/mol. Its IUPAC name is chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane.
Molecular Properties
| Compound Name | chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane |
| PubChem CID | 140664464 |
| Molecular Formula | C28H39ClSi |
| Molecular Weight | 439.16 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane |
| SMILES | CC(C)C1=Cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2C1[Si](C)(C)Cl |
| InChI | InChI=1S/C28H39ClSi/c1-18(2)24-17-25-22(12-11-13-23(25)26(24)30(9,10)29)19-14-20(27(3,4)5)16-21(15-19)28(6,7)8/h11-18,26H,1-10H3 |
| InChIKey | OHODEYZWMMORAE-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.16 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane?
The IUPAC name of chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane (CID 140664464) is chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane.
What is the SMILES notation for chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane?
The canonical SMILES for chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane is CC(C)C1=Cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2C1[Si](C)(C)Cl.
What is the InChIKey of chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane?
The InChIKey is OHODEYZWMMORAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39ClSi/c1-18(2)24-17-25-22(12-11-13-23(25)26(24)30(9,10)29)19-14-20(27(3,4)5)16-21(15-19)28(6,7)8/h11-18,26H,1-10H3.
What are the key properties of chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane?
chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane has a molecular weight of 439.16 g/mol, XLogP of 9.07, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]-dimethylsilane is sourced from PubChem (CID 140664464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).