C38H33N3O5 — CID 140664739
[8-(hydroxy-phenyl-pyridin-2-ylmethyl)-3,5-dioxo-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl butanoate (PubChem CID 140664739) has the molecular formula C38H33N3O5 and a molecular weight of 611.70 g/mol. Its IUPAC name is [8-(hydroxy-phenyl-pyridin-2-ylmethyl)-3,5-dioxo-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl butanoate.
| Compound Name | [8-(hydroxy-phenyl-pyridin-2-ylmethyl)-3,5-dioxo-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl butanoate |
|---|---|
| PubChem CID | 140664739 |
| Molecular Formula | C38H33N3O5 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | [8-(hydroxy-phenyl-pyridin-2-ylmethyl)-3,5-dioxo-10-[phenyl(pyridin-2-yl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl butanoate |
| SMILES | CCCC(=O)OCN1C(=O)C2C3C=C(C(O)(c4ccccc4)c4ccccn4)C(C3=C(c3ccccc3)c3ccccn3)C2C1=O |
| InChI | InChI=1S/C38H33N3O5/c1-2-13-30(42)46-23-41-36(43)33-26-22-27(38(45,25-16-7-4-8-17-25)29-19-10-12-21-40-29)34(35(33)37(41)44)32(26)31(24-14-5-3-6-15-24)28-18-9-11-20-39-28/h3-12,14-22,26,33-35,45H,2,13,23H2,1H3 |
| InChIKey | BQJXNNDIWCKZHU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|