About CID 140664844
CID 140664844 (PubChem CID 140664844) has the molecular formula HO3S
and a molecular weight of 83.08 g/mol.
Molecular Properties
| Compound Name | CID 140664844 |
| PubChem CID | 140664844 |
| Molecular Formula | HO3S |
| Molecular Weight | 83.08 g/mol |
| Exact Mass | 82.97 |
| IUPAC Name | — |
| SMILES | [3H]S([O])(=O)=O |
| InChI | InChI=1S/HO3S/c1-4(2)3/h4H/i4T |
| InChIKey | XDYBIPXVKHSRRE-IBTRZKOZSA-N |
| XLogP | -1.06 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.08 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 140664844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140664844?
The IUPAC name of CID 140664844 (CID 140664844) is not available.
What is the SMILES notation for CID 140664844?
The canonical SMILES for CID 140664844 is [3H]S([O])(=O)=O.
What is the InChIKey of CID 140664844?
The InChIKey is XDYBIPXVKHSRRE-IBTRZKOZSA-N. The full InChI is InChI=1S/HO3S/c1-4(2)3/h4H/i4T.
What are the key properties of CID 140664844?
CID 140664844 has a molecular weight of 83.08 g/mol, XLogP of -1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140664844 is sourced from PubChem (CID 140664844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).