C19H26ClNO3 — CID 140665091
5-cyclopentyl-7-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-8-carboxylic acid;hydrochloride (PubChem CID 140665091) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is 5-cyclopentyl-7-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-8-carboxylic acid;hydrochloride.
| Compound Name | 5-cyclopentyl-7-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-8-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 140665091 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-cyclopentyl-7-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-8-carboxylic acid;hydrochloride |
| SMILES | Cc1c(C(=O)O)ccc2c1NC(C1CCCC1)C1CCCOC21.Cl |
| InChI | InChI=1S/C19H25NO3.ClH/c1-11-13(19(21)22)8-9-15-16(11)20-17(12-5-2-3-6-12)14-7-4-10-23-18(14)15;/h8-9,12,14,17-18,20H,2-7,10H2,1H3,(H,21,22);1H |
| InChIKey | JFSBJSONNKEYEF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |