C22H31N3O5 — CID 140665218
(11Z)-2-[2-(4-tert-butylpiperidin-1-yl)ethoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione (PubChem CID 140665218) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is (11Z)-2-[2-(4-tert-butylpiperidin-1-yl)ethoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione.
| Compound Name | (11Z)-2-[2-(4-tert-butylpiperidin-1-yl)ethoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione |
|---|---|
| PubChem CID | 140665218 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (11Z)-2-[2-(4-tert-butylpiperidin-1-yl)ethoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione |
| SMILES | CC(C)(C)C1CCN(CCOc2nn3c4c2OC(=O)/C=C\C(=O)OC4CCC3)CC1 |
| InChI | InChI=1S/C22H31N3O5/c1-22(2,3)15-8-11-24(12-9-15)13-14-28-21-20-19-16(5-4-10-25(19)23-21)29-17(26)6-7-18(27)30-20/h6-7,15-16H,4-5,8-14H2,1-3H3/b7-6- |
| InChIKey | ZXCVWFNUDZRXSK-SREVYHEPSA-N |
| XLogP | 2.87 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |