C19H34O5Si — CID 140666026
2-[(2R)-3-[(3R,4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetaldehyde (PubChem CID 140666026) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is 2-[(2R)-3-[(3R,4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetaldehyde.
| Compound Name | 2-[(2R)-3-[(3R,4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 140666026 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-[(2R)-3-[(3R,4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetaldehyde |
| SMILES | CO[C@H]1[C@H](C2(C)O[C@@H]2CC=O)[C@]2(CC[C@H]1O[Si](C)(C)C(C)(C)C)CO2 |
| InChI | InChI=1S/C19H34O5Si/c1-17(2,3)25(6,7)24-13-8-10-19(12-22-19)16(15(13)21-5)18(4)14(23-18)9-11-20/h11,13-16H,8-10,12H2,1-7H3/t13-,14-,15-,16-,18?,19+/m1/s1 |
| InChIKey | MFBVMLLSEKMNJG-JUSXUFPHSA-N |
| XLogP | 3.32 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|