C19H19O9S- — CID 140666566
3-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl]oxy]propane-1-sulfonate (PubChem CID 140666566) has the molecular formula C19H19O9S- and a molecular weight of 423.42 g/mol. Its IUPAC name is 3-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl]oxy]propane-1-sulfonate.
| Compound Name | 3-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl]oxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 140666566 |
| Molecular Formula | C19H19O9S- |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 3-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl]oxy]propane-1-sulfonate |
| SMILES | COc1ccc(C2CC(=O)c3c(O)cc(OCCCS(=O)(=O)[O-])cc3O2)cc1O |
| InChI | InChI=1S/C19H20O9S/c1-26-16-4-3-11(7-13(16)20)17-10-15(22)19-14(21)8-12(9-18(19)28-17)27-5-2-6-29(23,24)25/h3-4,7-9,17,20-21H,2,5-6,10H2,1H3,(H,23,24,25)/p-1 |
| InChIKey | URXPAJGIBLAGRG-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|