About N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline (PubChem CID 140666659) has the molecular formula C18H23F2NOSi
and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline.
Molecular Properties
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline |
| PubChem CID | 140666659 |
| Molecular Formula | C18H23F2NOSi |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H23F2NOSi/c1-18(2,3)23(4,5)22-15-9-6-13(7-10-15)21-14-8-11-16(19)17(20)12-14/h6-12,21H,1-5H3 |
| InChIKey | ZMWRJRBPGBNYRE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline?
The IUPAC name of N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline (CID 140666659) is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline.
What is the SMILES notation for N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline?
The canonical SMILES for N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline is CC(C)(C)[Si](C)(C)Oc1ccc(Nc2ccc(F)c(F)c2)cc1.
What is the InChIKey of N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline?
The InChIKey is ZMWRJRBPGBNYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2NOSi/c1-18(2,3)23(4,5)22-15-9-6-13(7-10-15)21-14-8-11-16(19)17(20)12-14/h6-12,21H,1-5H3.
What are the key properties of N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline?
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline has a molecular weight of 335.47 g/mol, XLogP of 6.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3,4-difluoroaniline is sourced from PubChem (CID 140666659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).